Difference between revisions of "PWY-7626"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] == * smiles: ** COC2(=CC1(=C(OC(C=C1)=O)C=C2OC3(C(C(C(O)C(CO)O3)O)O))) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10284 CPD-10284] == * smiles: ** CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10284 CPD-10284] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IQNFBGHLIVBNOU-QSGBVPJFSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-myristoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 987.845 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxotetradecanoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14268]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12507]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05261 C05261] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62543 62543] |
| − | * | + | * BIGG : 45449 |
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245316 25245316] |
| − | {{#set: common name= | + | * HMDB : HMDB03935 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=IQNFBGHLIVBNOU-QSGBVPJFSA-J}} |
| + | {{#set: common name=3-oxo-myristoyl-CoA}} | ||
| + | {{#set: molecular weight=987.845 }} | ||
| + | {{#set: common name=3-oxotetradecanoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-14268}} | ||
| + | {{#set: produced by=RXN-12507}} | ||
Revision as of 13:30, 21 March 2018
Contents
Metabolite CPD-10284
- smiles:
- CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=IQNFBGHLIVBNOU-QSGBVPJFSA-J
- common name:
- 3-oxo-myristoyl-CoA
- molecular weight:
- 987.845
- Synonym(s):
- 3-oxotetradecanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
