Difference between revisions of "PWY-5669"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10657 RXN-10657] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogena...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10657 RXN-10657] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
 +
* inchi key:
 +
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
 
* common name:
 
* common name:
−
** Glucose/ribitol dehydrogenase
+
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-14]]
−
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Trans-D3-cis-D7-tetradecenoyl-ACPs]][c] '''=>''' 1 [[Cis-Delta7-tetradecenoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-13]]
−
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans-Δ3-cis-Δ7-tetradecenoyl-[acp][c] '''=>''' 1 a cis-Δ7-tetradecenoyl-[acp][c] '''+''' 1 NAD+[c]
+
* [[RXN-13707]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_002470]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Glucose/ribitol dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200473 25200473]
−
{{#set: ec number=EC-1.3.1.9}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
−
{{#set: gene associated=Ec-27_002470}}
+
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
−
{{#set: in pathway=PWY-6282}}
+
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: consumed by=RXN66-14}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN66-13|RXN-13707}}

Revision as of 13:30, 21 March 2018

Metabolite CPD-8609

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
  • inchi key:
    • InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
  • common name:
    • 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5669&oldid=19140"