Difference between revisions of "Ec-15 001630"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...")
(Created page with "Category:Gene == Gene Ec-12_001770 == * left end position: ** 1699787 * transcription direction: ** NEGATIVE * right end position: ** 1701948 * centisome position: ** 20.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] ==
+
== Gene Ec-12_001770 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
** 1699787
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** aldehydo-D-glucuronate
+
** 1701948
−
* molecular weight:
+
* centisome position:
−
** 193.133    
+
** 20.390793    
 
* Synonym(s):
 
* Synonym(s):
−
** aldehydo-D-glucuronic acid
+
** Esi_0144_0080
 +
** Esi0144_0080
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14693]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1699787}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1701948}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953]
+
{{#set: centisome position=20.390793   }}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
{{#set: common name=Esi_0144_0080|Esi0144_0080}}
−
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}}
+
{{#set: reaction associated=PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
−
{{#set: common name=aldehydo-D-glucuronate}}
+
−
{{#set: molecular weight=193.133   }}
+
−
{{#set: common name=aldehydo-D-glucuronic acid}}
+
−
{{#set: reversible reaction associated=RXN-14693}}
+

Revision as of 13:30, 21 March 2018

Gene Ec-12_001770

  • left end position:
    • 1699787
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1701948
  • centisome position:
    • 20.390793
  • Synonym(s):
    • Esi_0144_0080
    • Esi0144_0080

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_001630&oldid=19187"