Difference between revisions of "Charged-GLT-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-11_004750 == * left end position: ** 4783703 * transcription direction: ** POSITIVE * right end position: ** 4791584 * centisome position: ** 76.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-11_004750 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
−
* left end position:
+
* smiles:
−
** 4783703
+
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
−
* right end position:
+
* common name:
−
** 4791584
+
** (5Z)-tetradecenoyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 76.05665    
+
** 971.845    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0071_0025
+
** cis-tetradec-5-enoyl-CoA
−
** Esi0071_0025
+
** 14:1 cis-5
−
** PK
+
** 14:1(n-9)
 +
** (5Z)-tetradec-5-enoyl-CoA
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-14576]]
−
** esiliculosus_genome
+
* [[RXN-17783]]
−
***go-term
+
== Reaction(s) known to produce the compound ==
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4783703}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
−
{{#set: right end position=4791584}}
+
* CHEBI:
−
{{#set: centisome position=76.05665   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
−
{{#set: common name=Esi_0071_0025|Esi0071_0025|PK}}
+
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
−
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
 +
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
 +
{{#set: molecular weight=971.845   }}
 +
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
 +
{{#set: consumed by=RXN-14576|RXN-17783}}

Revision as of 13:31, 21 March 2018

Metabolite CPD-15436

  • smiles:
    • CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
  • common name:
    • (5Z)-tetradecenoyl-CoA
  • molecular weight:
    • 971.845
  • Synonym(s):
    • cis-tetradec-5-enoyl-CoA
    • 14:1 cis-5
    • 14:1(n-9)
    • (5Z)-tetradec-5-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Charged-GLT-tRNAs&oldid=19379"