Difference between revisions of "BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C(OP([O-])(OCC(CO)O)=O)C[N+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N |
* common name: | * common name: | ||
| − | ** | + | ** sn-glycero-3-phosphoethanolamine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 215.142 |
* Synonym(s): | * Synonym(s): | ||
| + | ** L-1-glycerophosphorylethanolamine | ||
| + | ** 1-glycerophosphorylethanolamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14160]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15035]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01233 C01233] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929] |
| − | * | + | * BIGG : 37147 |
| − | {{#set: smiles=C(O) | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678815 70678815] |
| − | {{#set: common name= | + | * HMDB : HMDB00114 |
| − | {{#set: molecular weight= | + | {{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N}} |
| + | {{#set: common name=sn-glycero-3-phosphoethanolamine}} | ||
| + | {{#set: molecular weight=215.142 }} | ||
| + | {{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}} | ||
| + | {{#set: consumed by=RXN-14160}} | ||
| + | {{#set: produced by=RXN-15035}} | ||
Revision as of 13:31, 21 March 2018
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- smiles:
- C(OP([O-])(OCC(CO)O)=O)C[N+]
- inchi key:
- InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
- common name:
- sn-glycero-3-phosphoethanolamine
- molecular weight:
- 215.142
- Synonym(s):
- L-1-glycerophosphorylethanolamine
- 1-glycerophosphorylethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(OCC(CO)O)=O)C[N+" cannot be used as a page name in this wiki.
