Difference between revisions of "PWY-7007"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14904 RXN-14904] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14904 RXN-14904] ==
* smiles:
+
* direction:
** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
+
* common name:
+
** cobalt-precorrin-2
+
* molecular weight:
+
** 912.701   
+
 
* Synonym(s):
 
* Synonym(s):
** cobalt-dihydrosirohydrochlorin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-10330]][c] '''<=>''' 1 [[CPD0-1108]][c]
* [[RXN-8759]]
+
* With common name(s):
 +
** 1 &alpha;-D-ribofuranose[c] '''<=>''' 1 &beta;-D-ribofuranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[RIBOKIN-PWY]], ribose degradation: [http://metacyc.org/META/NEW-IMAGE?object=RIBOKIN-PWY RIBOKIN-PWY]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486]
+
{{#set: in pathway=RIBOKIN-PWY}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}}
+
{{#set: common name=cobalt-precorrin-2}}
+
{{#set: molecular weight=912.701    }}
+
{{#set: common name=cobalt-dihydrosirohydrochlorin}}
+
{{#set: reversible reaction associated=RXN-8759}}
+

Revision as of 13:32, 21 March 2018

Reaction RXN-14904

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 α-D-ribofuranose[c] <=> 1 β-D-ribofuranose[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links