Difference between revisions of "CPD-12601"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-P-PANTOTHENATE 4-P-PANTOTHENATE] == * smiles: ** CC(C(C(=O)NCCC(=O)[O-])O)(COP([O-])([O-])=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)N...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J |
* common name: | * common name: | ||
| − | ** | + | ** dUTP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 464.112 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** deoxy-UTP |
| − | ** | + | ** 2'-deoxyuridine-5'-triphosphate |
| − | ** | + | ** deoxyuridine-triphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DUTP-PYROP-RXN]] | ||
| + | * [[RXN-14199]] | ||
| + | * [[RXN-14219]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DUDPKIN-RXN]] |
| + | * [[RXN0-724]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 1173-82-6 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] |
| − | * HMDB : | + | * HMDB : HMDB01191 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] |
| − | * | + | * BIGG : 35037 |
| − | {{#set: smiles= | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=dUTP}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=464.112 }} |
| − | {{#set: common name= | + | {{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} |
| − | {{#set: produced by= | + | {{#set: consumed by=DUTP-PYROP-RXN|RXN-14199|RXN-14219}} |
| + | {{#set: produced by=DUDPKIN-RXN|RXN0-724}} | ||
Revision as of 13:32, 21 March 2018
Contents
Metabolite DUTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
- inchi key:
- InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
- common name:
- dUTP
- molecular weight:
- 464.112
- Synonym(s):
- deoxy-UTP
- 2'-deoxyuridine-5'-triphosphate
- deoxyuridine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.
