Difference between revisions of "PWY-5063"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_003500 == * left end position: ** 3727932 * transcription direction: ** NEGATIVE * right end position: ** 3736491 * centisome position: ** 72.2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-20_003500 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] ==
* left end position:
+
* smiles:
** 3727932
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
* right end position:
+
* common name:
** 3736491
+
** (22α)-hydroxy-campesterol
* centisome position:
+
* molecular weight:
** 72.29689    
+
** 416.686    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0010_0019
+
** (22S)-22-hydroxy-campesterol
** Esi0010_0019
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-4225]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RIBITOLUTIL-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3727932}}
+
* LIPID_MAPS : LMST01031115
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=3736491}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11133505 11133505]
{{#set: centisome position=72.29689   }}
+
* CHEMSPIDER:
{{#set: common name=Esi_0010_0019|Esi0010_0019}}
+
** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624]
{{#set: reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
+
* CHEBI:
{{#set: pathway associated=RIBITOLUTIL-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}}
 +
{{#set: common name=(22α)-hydroxy-campesterol}}
 +
{{#set: molecular weight=416.686   }}
 +
{{#set: common name=(22S)-22-hydroxy-campesterol}}
 +
{{#set: produced by=RXN-4225}}

Revision as of 13:32, 21 March 2018

Metabolite CPD-3943

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
  • common name:
    • (22α)-hydroxy-campesterol
  • molecular weight:
    • 416.686
  • Synonym(s):
    • (22S)-22-hydroxy-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.