Difference between revisions of "SERINE-O-ACETTRAN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Gene == Gene Ec-11_006140 == * left end position: ** 6118655 * transcription direction: ** NEGATIVE * right end position: ** 6122213 * centisome position: ** 97.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_006140 == |
− | * | + | * left end position: |
− | ** | + | ** 6118655 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6122213 |
− | * | + | * centisome position: |
− | ** | + | ** 97.281204 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0031_0140 |
− | ** | + | ** Esi0031_0140 |
+ | ** FMT | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6118655}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6122213}} | |
− | + | {{#set: centisome position=97.281204 }} | |
− | + | {{#set: common name=Esi_0031_0140|Esi0031_0140|FMT}} | |
− | + | {{#set: reaction associated=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:32, 21 March 2018
Gene Ec-11_006140
- left end position:
- 6118655
- transcription direction:
- NEGATIVE
- right end position:
- 6122213
- centisome position:
- 97.281204
- Synonym(s):
- Esi_0031_0140
- Esi0031_0140
- FMT
Reactions associated
- Reaction: METHIONYL-TRNA-FORMYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome