Difference between revisions of "Negatively-super-coiled-DNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6131 PWY-6131] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4895 TAX-48...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6131 PWY-6131] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4895 TAX-4895] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** glycerol degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[GLYCERONE-KINASE-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-18_002130]] |
− | * [ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLYCDEH-RXN GLYCDEH-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4895}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=glycerol degradation II}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:33, 21 March 2018
Pathway PWY-6131
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- GLYCERONE-KINASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: