Difference between revisions of "Negatively-super-coiled-DNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6131 PWY-6131] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4895 TAX-48...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6131 PWY-6131] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4895 TAX-4895]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
+
 
* common name:
 
* common name:
−
** shikimate
+
** glycerol degradation II
−
* molecular weight:
+
−
** 173.145   
+
 
* Synonym(s):
 
* Synonym(s):
−
** shikimic acid
 
−
** (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-7968]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[GLYCERONE-KINASE-RXN]]
−
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-18_002130]]
−
* [[SHIKIMATE-KINASE-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCDEH-RXN GLYCDEH-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 138-59-0
+
{{#set: taxonomic range=TAX-4895}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7057976 7057976]
+
{{#set: common name=glycerol degradation II}}
−
* HMDB : HMDB03070
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: total reaction=2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00493 C00493]
+
{{#set: completion rate=50.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5414360.html 5414360]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36208 36208]
+
−
* BIGG : 35144
+
−
{{#set: smiles=C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M}}
+
−
{{#set: common name=shikimate}}
+
−
{{#set: molecular weight=173.145    }}
+
−
{{#set: common name=shikimic acid|(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate}}
+
−
{{#set: consumed by=RXN-7968}}
+
−
{{#set: produced by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
+
−
{{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN}}
+

Revision as of 13:33, 21 March 2018

Pathway PWY-6131

  • taxonomic range:
  • common name:
    • glycerol degradation II
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Negatively-super-coiled-DNAs&oldid=19581"