Difference between revisions of "Ec-24 001990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phytate biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''5''' reactions in the full pathway |
− | * | + | * [[2.7.1.127-RXN]] |
− | * | + | ** 1 associated gene(s): |
− | * | + | *** [[Ec-16_003350]] |
− | * | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-esiliculosus_genome]] |
− | * | + | * [[RXN-7163]] |
− | * | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Ec-16_003350]] |
− | * [[ | + | *** [[Ec-18_000620]] |
− | + | ** 1 reconstruction source(s) associated: | |
− | * | + | *** [[annotation-esiliculosus_genome]] |
− | * [[ | + | == Reaction(s) not found == |
− | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.151-RXN 2.7.1.151-RXN] |
− | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7162 RXN-7162] |
− | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7184 RXN-7184] | |
− | * [[ | + | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | * [ | + | |
− | + | ||
− | * [ | + | |
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3)}} | |
− | + | {{#set: common name=phytate biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=40.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 14:33, 21 March 2018
Pathway PWY-6361
- taxonomic range:
- common name:
- 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3)
- Synonym(s):
- phytate biosynthesis
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- 2.7.1.127-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-7163
- 2 associated gene(s):
- 1 reconstruction source(s) associated: