Difference between revisions of "Myristoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
(Created page with "Category:Gene == Gene Ec-23_002410 == * left end position: ** 2532344 * transcription direction: ** POSITIVE * right end position: ** 2537603 * centisome position: ** 52.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Gene Ec-23_002410 ==
−
* smiles:
+
* left end position:
−
** CC(=O)NC(CCSC)C([O-])=O
+
** 2532344
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N-α-acetyl-L-methionine
+
** 2537603
−
* molecular weight:
+
* centisome position:
−
** 190.237    
+
** 52.32692    
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-L-methionine
+
** Esi_0132_0065
 +
** Esi0132_0065
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLYCPDIESTER-RXN]]
−
* [[RXN0-6948]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN-14073]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-14136]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-14160]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[PWY-6952]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01646
+
{{#set: left end position=2532344}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
{{#set: right end position=2537603}}
−
* HMDB : HMDB11745
+
{{#set: centisome position=52.32692   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0132_0065|Esi0132_0065}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
{{#set: reaction associated=GLYCPDIESTER-RXN|RXN-14073|RXN-14136|RXN-14160}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-7409|PWY-6952}}
−
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
−
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
−
{{#set: common name=N-α-acetyl-L-methionine}}
+
−
{{#set: molecular weight=190.237   }}
+
−
{{#set: common name=N-acetyl-L-methionine}}
+
−
{{#set: produced by=RXN0-6948}}
+

Revision as of 13:33, 21 March 2018

Gene Ec-23_002410

  • left end position:
    • 2532344
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2537603
  • centisome position:
    • 52.32692
  • Synonym(s):
    • Esi_0132_0065
    • Esi0132_0065

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Myristoyl-ACPs&oldid=19626"