Difference between revisions of "CPD-17813"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == * smiles: ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Acyl-sn-glycerol-3-phosphates 2-Acyl-sn-glycerol-3-phosphates] == * common name: ** a 2-acyl-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Acyl-sn-glycerol-3-phosphates 2-Acyl-sn-glycerol-3-phosphates] ==
−
* smiles:
+
−
** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
+
−
* inchi key:
+
−
** InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N
+
 
* common name:
 
* common name:
−
** 9,9'-di-cis-ζ-carotene
+
** a 2-acyl-sn-glycerol 3-phosphate
−
* molecular weight:
+
−
** 540.914   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 2-acyl-sn-glycerol 3P
 +
** a 1-lysophosphatidate
 +
** a 1-lyso-LPA
 +
** a 1-lyso-phosphatidic acid
 +
** a 1-lyso-phosphatidate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11356]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-12242]]
+
* [[RXN-13112]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 2-acyl-sn-glycerol 3-phosphate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440490 6440490]
+
{{#set: common name=a 2-acyl-sn-glycerol 3P|a 1-lysophosphatidate|a 1-lyso-LPA|a 1-lyso-phosphatidic acid|a 1-lyso-phosphatidate}}
−
* CHEMSPIDER:
+
{{#set: reversible reaction associated=RXN-13112}}
−
** [http://www.chemspider.com/Chemical-Structure.4944750.html 4944750]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48716 48716]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15857 C15857]
+
−
* HMDB : HMDB03063
+
−
{{#set: smiles=CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N}}
+
−
{{#set: common name=9,9'-di-cis-ζ-carotene}}
+
−
{{#set: molecular weight=540.914    }}
+
−
{{#set: consumed by=RXN-11356}}
+
−
{{#set: reversible reaction associated=RXN-12242}}
+

Revision as of 13:33, 21 March 2018

Metabolite 2-Acyl-sn-glycerol-3-phosphates

  • common name:
    • a 2-acyl-sn-glycerol 3-phosphate
  • Synonym(s):
    • a 2-acyl-sn-glycerol 3P
    • a 1-lysophosphatidate
    • a 1-lyso-LPA
    • a 1-lyso-phosphatidic acid
    • a 1-lyso-phosphatidate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-17813&oldid=19663"