Difference between revisions of "ExchangeSeed FE+2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phospholipids Phospholipids] == * common name: ** a phospholipid * Synonym(s): == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == * smiles: ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** presqualene diphosphate |
+ | * molecular weight: | ||
+ | ** 583.66 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13724]] |
+ | * [[RXN66-281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12263]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03428 C03428] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57310 57310] | ||
+ | * METABOLIGHTS : MTBLC57310 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634] | ||
+ | * HMDB : HMDB01278 | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K}} | ||
+ | {{#set: common name=presqualene diphosphate}} | ||
+ | {{#set: molecular weight=583.66 }} | ||
+ | {{#set: consumed by=RXN-13724|RXN66-281}} | ||
+ | {{#set: produced by=RXN-12263}} |
Revision as of 13:34, 21 March 2018
Contents
Metabolite CPD-465
- smiles:
- CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C
- inchi key:
- InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K
- common name:
- presqualene diphosphate
- molecular weight:
- 583.66
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C" cannot be used as a page name in this wiki.