Difference between revisions of "Ec-27 005100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
* inchi key:
+
−
** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
+
 
* common name:
 
* common name:
−
** glycerophosphoserine
+
** histamine degradation
−
* molecular weight:
+
−
** 258.144   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-14136]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-10089]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-11_002450]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE-N-METHYLTRANSFERASE-RXN HISTAMINE-N-METHYLTRANSFERASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9600 RXN-9600]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-MAP:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00340 map00340]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33208}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931]
+
{{#set: common name=histamine degradation}}
−
* BIGG : 1484554
+
{{#set: reaction found=1}}
−
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}}
+
{{#set: total reaction=3}}
−
{{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}}
+
{{#set: completion rate=33.0}}
−
{{#set: common name=glycerophosphoserine}}
+
−
{{#set: molecular weight=258.144    }}
+
−
{{#set: consumed by=RXN-14136}}
+

Revision as of 13:34, 21 March 2018

Pathway PWY-6181

  • taxonomic range:
  • common name:
    • histamine degradation
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005100&oldid=19734"