Difference between revisions of "CODH-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5-NUCLEOTID-RXN 5-NUCLEOTID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 5'-nucleotidase...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5-NUCLEOTID-RXN 5-NUCLEOTID-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 5'-nucleotidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Ribonucleoside-Monophosphates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Ribonucleosides]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a ribonucleoside 5'-monophosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 a ribonucleoside[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_005060]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-05_000950]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-15_000820]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07297 R07297] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P06196 P06196] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P21588 P21588] |
− | * | + | ** [http://www.uniprot.org/uniprot/O34313 O34313] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9KM44 Q9KM44] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O29385 O29385] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44569 P44569] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O83142 O83142] |
− | * | + | ** [http://www.uniprot.org/uniprot/P49902 P49902] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P22848 P22848] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q05927 Q05927] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P21589 P21589] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P29240 P29240] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07024 P07024] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
+ | {{#set: common name=5'-nucleotidase}} | ||
+ | {{#set: ec number=EC-3.1.3.5}} | ||
+ | {{#set: gene associated=Ec-12_005060|Ec-05_000950|Ec-15_000820}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:34, 21 March 2018
Contents
Reaction 5-NUCLEOTID-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 5'-nucleotidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Ribonucleoside-Monophosphates[c] + 1 WATER[c] => 1 Pi[c] + 1 Ribonucleosides[c]
- With common name(s):
- 1 a ribonucleoside 5'-monophosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 a ribonucleoside[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_005060
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-05_000950
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-15_000820
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
- UNIPROT: