Difference between revisions of "REDUCED-MENAQUINONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADH-RXN ENOYL-ACP-REDUCT-NADH-RXN] == * direction: ** LEFT-TO-RIGHT * common name...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-ACP-REDUCT-NADH-RXN ENOYL-ACP-REDUCT-NADH-RXN] ==
* smiles:
+
* direction:
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
+
 
* common name:
 
* common name:
** dihydrogeranylgeranyl diphosphate
+
** 2,3,4-saturated-fatty-acid-[acp] reductase
* molecular weight:
+
** Glucose/ribitol dehydrogenase
** 449.44   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
** dihydroGGPP
 
** dihydrogeranylgeranyl-PP
 
** dihydrogeranylgeranyl pyrophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-7659]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[TRANS-D2-ENOYL-ACP]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Saturated-Fatty-Acyl-ACPs]][c] '''+''' 1 [[NAD]][c]
* [[RXN-7658]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a trans-2-enoyl-[acyl-carrier protein][c] '''+''' 1 NADH[c] '''=>''' 1 a 2,3,4-saturated fatty acyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[FASYN-ELONG-PWY]], fatty acid elongation -- saturated: [http://metacyc.org/META/NEW-IMAGE?object=FASYN-ELONG-PWY FASYN-ELONG-PWY]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* UNIPROT:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
+
** [http://www.uniprot.org/uniprot/P16657 P16657]
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
** [http://www.uniprot.org/uniprot/O24990 O24990]
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
+
** [http://www.uniprot.org/uniprot/Q9JSS8 Q9JSS8]
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
+
** [http://www.uniprot.org/uniprot/P0A5Y6 P0A5Y6]
{{#set: molecular weight=449.44    }}
+
** [http://www.uniprot.org/uniprot/O84106 O84106]
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
+
** [http://www.uniprot.org/uniprot/Q9PMQ7 Q9PMQ7]
{{#set: consumed by=RXN-7659}}
+
** [http://www.uniprot.org/uniprot/P07149 P07149]
{{#set: produced by=RXN-7658}}
+
** [http://www.uniprot.org/uniprot/P0AEK4 P0AEK4]
 +
** [http://www.uniprot.org/uniprot/Q51891 Q51891]
 +
** [http://www.uniprot.org/uniprot/O04945 O04945]
 +
** [http://www.uniprot.org/uniprot/O04946 O04946]
 +
** [http://www.uniprot.org/uniprot/O24207 O24207]
 +
** [http://www.uniprot.org/uniprot/P93062 P93062]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=2,3,4-saturated-fatty-acid-[acp] reductase}}
 +
{{#set: common name=Glucose/ribitol dehydrogenase}}
 +
{{#set: ec number=EC-1.3.1.9}}
 +
{{#set: gene associated=Ec-27_002470}}
 +
{{#set: in pathway=FASYN-ELONG-PWY}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:34, 21 March 2018

Reaction ENOYL-ACP-REDUCT-NADH-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2,3,4-saturated-fatty-acid-[acp] reductase
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"2,3,4-saturated-fatty-acid-[acp] reductase" cannot be used as a page name in this wiki.