Difference between revisions of "RXN-12518"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-11_005220 == * Synonym(s): ** Esi_0071_0103 ** Esi0071_0103 ** UGGT == Reactions associated == * Reaction: RXN-15117 ** Source: orthology-a...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_005220 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0071_0103 |
− | ** | + | ** Esi0071_0103 |
− | ** | + | ** UGGT |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * | + | * Reaction: [[RXN-15117]] |
− | + | ** Source: [[orthology-aragem]] | |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0071_0103|Esi0071_0103|UGGT}} | |
− | + | {{#set: reaction associated=RXN-15117}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 14:34, 21 March 2018
Gene Ec-11_005220
- Synonym(s):
- Esi_0071_0103
- Esi0071_0103
- UGGT
Reactions associated
- Reaction: RXN-15117
- Source: orthology-aragem