Difference between revisions of "CPD-7015"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6483 PWY-6483] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6483 PWY-6483] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
+
* inchi key:
 +
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
 
* common name:
 
* common name:
−
** ceramide degradation
+
** dihydrogeranylgeranyl diphosphate
 +
* molecular weight:
 +
** 449.44   
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydroGGPP
 +
** dihydrogeranylgeranyl-PP
 +
** dihydrogeranylgeranyl pyrophosphate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-7659]]
−
* [[RXN-11375]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
* [[RXN-7658]]
−
*** [[Ec-26_006010]]
+
== Reaction(s) of unknown directionality ==
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11376 RXN-11376]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11377 RXN-11377]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33154}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
−
{{#set: common name=ceramide degradation}}
+
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
−
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
−
{{#set: total reaction=3}}
+
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
−
{{#set: completion rate=33.0}}
+
{{#set: molecular weight=449.44    }}
 +
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
 +
{{#set: consumed by=RXN-7659}}
 +
{{#set: produced by=RXN-7658}}

Revision as of 13:35, 21 March 2018

Metabolite CPD-7002

  • smiles:
    • CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
  • common name:
    • dihydrogeranylgeranyl diphosphate
  • molecular weight:
    • 449.44
  • Synonym(s):
    • dihydroGGPP
    • dihydrogeranylgeranyl-PP
    • dihydrogeranylgeranyl pyrophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7015&oldid=19863"