Difference between revisions of "RXN-10658"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-long-chain-fatty-acids Very-long-chain-fatty-acids] == * common name: ** a very-long-chain...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-long-chain-fatty-acids Very-long-chain-fatty-acids] ==
* smiles:
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
+
 
* common name:
 
* common name:
** 4-cis-undecenoyl-CoA
+
** a very-long-chain fatty acid
* molecular weight:
+
** 929.765   
+
 
* Synonym(s):
 
* Synonym(s):
** 4Z-undecenoyl-CoA
+
** VLCFA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14775]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-16415]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a very-long-chain fatty acid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658173 90658173]
+
{{#set: common name=VLCFA}}
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reversible reaction associated=RXN-16415}}
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J}}
+
{{#set: common name=4-cis-undecenoyl-CoA}}
+
{{#set: molecular weight=929.765    }}
+
{{#set: common name=4Z-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14775}}
+

Revision as of 13:35, 21 March 2018

Metabolite Very-long-chain-fatty-acids

  • common name:
    • a very-long-chain fatty acid
  • Synonym(s):
    • VLCFA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links