Difference between revisions of "L-SELENOCYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * smiles: ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) * inchi key: ** InChIKey=ZOAM...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11693 RXN-11693] == * direction: ** LEFT-TO-RIGHT * common name: ** separin * ec number: ** [ht...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11693 RXN-11693] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** separin |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.4.22.49 EC-3.4.22.49] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[RAD21-Cohesin-Subunits]][c] '''=>''' 1 [[Peptides-holder]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 a RAD21 cohesin subunit[c] '''=>''' 1 a peptide[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-01_011880]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=separin}} | |
| − | + | {{#set: ec number=EC-3.4.22.49}} | |
| − | + | {{#set: gene associated=Ec-01_011880}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:35, 21 March 2018
Contents
Reaction RXN-11693
- direction:
- LEFT-TO-RIGHT
- common name:
- separin
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 RAD21-Cohesin-Subunits[c] => 1 Peptides-holder[c]
- With common name(s):
- 1 H2O[c] + 1 a RAD21 cohesin subunit[c] => 1 a peptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_011880
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
