Difference between revisions of "RXN-14200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
−
** InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K
+
 
* common name:
 
* common name:
−
** IDP
+
** cis-vaccenate biosynthesis
−
* molecular weight:
+
−
** 425.165   
+
 
* Synonym(s):
 
* Synonym(s):
−
** riboxin
+
** cis vaccenic acid acid biosynthesis
−
** inosine diphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-14003]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.3.1.179-RXN]]
−
* [[RXN0-5073]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[RXN-14120]]
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9555]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9556]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9557]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9558]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 86-04-4
+
* ECOCYC:
−
* BIGG : 33869
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5973 PWY-5973]
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7156952 7156952]
+
{{#set: taxonomic range=TAX-3398}}
−
* HMDB : HMDB03335
+
{{#set: common name=cis-vaccenate biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: common name=cis vaccenic acid acid biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00104 C00104]
+
{{#set: reaction found=5}}
−
* CHEMSPIDER:
+
{{#set: total reaction=5}}
−
** [http://www.chemspider.com/Chemical-Structure.3279691.html 3279691]
+
{{#set: completion rate=100.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58280 58280]
+
−
* METABOLIGHTS : MTBLC58280
+
−
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K}}
+
−
{{#set: common name=IDP}}
+
−
{{#set: molecular weight=425.165    }}
+
−
{{#set: common name=riboxin|inosine diphosphate}}
+
−
{{#set: consumed by=RXN-14003}}
+
−
{{#set: produced by=RXN0-5073}}
+
−
{{#set: reversible reaction associated=RXN-14120}}
+

Revision as of 13:35, 21 March 2018

Pathway PWY-5973

  • taxonomic range:
  • common name:
    • cis-vaccenate biosynthesis
  • Synonym(s):
    • cis vaccenic acid acid biosynthesis

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14200&oldid=19966"