Difference between revisions of "Ec-21 001540"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14003 RXN-14003] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14003 RXN-14003] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.64 EC-3.6.1.64] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[IDP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[IMP]][c] '''+''' 1 [[Pi]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 IDP[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 IMP[c] '''+''' 1 phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-10_003360]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.6.1.64}} | |
− | + | {{#set: gene associated=Ec-10_003360}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-aragem}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:36, 21 March 2018
Contents
Reaction RXN-14003
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 IDP[c] + 1 H2O[c] => 1 H+[c] + 1 IMP[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_003360
- Source: orthology-aragem
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem