Difference between revisions of "CPD-8892"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** COC1(C(O)C(O)C(O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N |
* common name: | * common name: | ||
| − | ** | + | ** D-ononitol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 194.184 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-O-methyl-myo-inositol | ||
| + | ** ononitol | ||
| + | ** 1D-4-O-methyl-myo-inositol | ||
| + | ** 4-methyl-myo-inositol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8281]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06352 C06352] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18266 18266] |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12300199 12300199] |
| − | * HMDB : | + | * HMDB : HMDB29915 |
| − | {{#set: smiles= | + | {{#set: smiles=COC1(C(O)C(O)C(O)C(O)C(O)1)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=D-ononitol}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=194.184 }} |
| − | {{#set: | + | {{#set: common name=4-O-methyl-myo-inositol|ononitol|1D-4-O-methyl-myo-inositol|4-methyl-myo-inositol}} |
| − | {{#set: | + | {{#set: consumed by=RXN-8281}} |
Revision as of 13:36, 21 March 2018
Contents
Metabolite 4-METHYL-MYO-INOSITOL
- smiles:
- COC1(C(O)C(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
- common name:
- D-ononitol
- molecular weight:
- 194.184
- Synonym(s):
- 4-O-methyl-myo-inositol
- ononitol
- 1D-4-O-methyl-myo-inositol
- 4-methyl-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
