Difference between revisions of "Phospholipid-Olefinic-Fatty-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6827 PWY-6827] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6827 PWY-6827] ==
−
* smiles:
+
* taxonomic range:
−
** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M
+
 
* common name:
 
* common name:
−
** (+)-pinobanksin
+
** gellan degradation
−
* molecular weight:
+
−
** 271.249   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2R,3R)-pinobanksin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
* [[RXN-7648]]
+
* [[RXN-12270]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-02_002980]]
 +
*** [[Ec-02_002970]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12269 RXN-12269]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09826 C09826]
+
{{#set: common name=gellan degradation}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28103 28103]
+
{{#set: total reaction=2}}
−
* METABOLIGHTS : MTBLC28103
+
{{#set: completion rate=50.0}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200970 25200970]
+
−
* HMDB : HMDB37506
+
−
{{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)}}
+
−
{{#set: inchi key=InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M}}
+
−
{{#set: common name=(+)-pinobanksin}}
+
−
{{#set: molecular weight=271.249    }}
+
−
{{#set: common name=(2R,3R)-pinobanksin}}
+
−
{{#set: produced by=RXN-7648}}
+

Revision as of 13:36, 21 March 2018

Pathway PWY-6827

  • taxonomic range:
  • common name:
    • gellan degradation
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Phospholipid-Olefinic-Fatty-Acids&oldid=20114"