Difference between revisions of "RXN-8759"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12383 RXN-12383] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12383 RXN-12383] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
−
* common name:
+
−
** sinapoyl-CoA
+
−
* molecular weight:
+
−
** 969.7   
+
 
* Synonym(s):
 
* Synonym(s):
−
** sinapinoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10919]]
+
** 2 [[DIACYLGLYCEROL]][c] '''<=>''' 1 [[Triacylglycerols]][c] '''+''' 1 [[CPD-409]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-1124]]
+
** 2 a 1,2-diacyl-sn-glycerol[c] '''<=>''' 1 a triacyl-sn-glycerol[c] '''+''' 1 a 2-monoglyceride[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225]
+
{{#set: ec number=EC-2.3.1}}
−
* CHEBI:
+
{{#set: in pathway=TRIGLSYN-PWY}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393]
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}}
+
−
{{#set: common name=sinapoyl-CoA}}
+
−
{{#set: molecular weight=969.7    }}
+
−
{{#set: common name=sinapinoyl-CoA}}
+
−
{{#set: produced by=RXN-10919}}
+
−
{{#set: reversible reaction associated=RXN-1124}}
+

Revision as of 13:37, 21 March 2018

Reaction RXN-12383

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 a 1,2-diacyl-sn-glycerol[c] <=> 1 a triacyl-sn-glycerol[c] + 1 a 2-monoglyceride[c]

Genes associated with this reaction

Pathways

  • TRIGLSYN-PWY, diacylglycerol and triacylglycerol biosynthesis: TRIGLSYN-PWY
    • 7 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8759&oldid=20157"