Difference between revisions of "Ec-06 008380"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORSYN-RXN ISOCHORSYN-RXN] == * direction: ** REVERSIBLE * common name: ** Enolase C-terminal d...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORSYN-RXN ISOCHORSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
 +
* inchi key:
 +
** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Enolase C-terminal domain-like
+
** diprenylphlorisovalerophenone
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/5.4.4.2 EC-5.4.4.2]
+
** 345.458   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxyhumulone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CHORISMATE]][c] '''<=>''' 1 [[ISOCHORISMATE]][c]
+
* [[RXN-7810]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 chorismate[c] '''<=>''' 1 isochorismate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-05_002520]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5837]], 1,4-dihydroxy-2-naphthoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5837 PWY-5837]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-5901]], 2,3-dihydroxybenzoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5901 PWY-5901]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6406]], salicylate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6406 PWY-6406]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18985 18985]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01717 R01717]
+
{{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}}
−
* UNIPROT:
+
{{#set: common name=diprenylphlorisovalerophenone}}
−
** [http://www.uniprot.org/uniprot/P23973 P23973]
+
{{#set: molecular weight=345.458    }}
−
** [http://www.uniprot.org/uniprot/P44613 P44613]
+
{{#set: common name=deoxyhumulone}}
−
** [http://www.uniprot.org/uniprot/P74053 P74053]
+
{{#set: produced by=RXN-7810}}
−
** [http://www.uniprot.org/uniprot/P0AEJ2 P0AEJ2]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=Enolase C-terminal domain-like}}
+
−
{{#set: ec number=EC-5.4.4.2}}
+
−
{{#set: gene associated=Ec-05_002520}}
+
−
{{#set: in pathway=PWY-5837|PWY-5901|PWY-6406}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 14:37, 21 March 2018

Metabolite CPD-7105

  • smiles:
    • CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
  • inchi key:
    • InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
  • common name:
    • diprenylphlorisovalerophenone
  • molecular weight:
    • 345.458
  • Synonym(s):
    • deoxyhumulone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_008380&oldid=20231"