Difference between revisions of "PWY-6012-1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...")
(Created page with "Category:Gene == Gene Ec-03_000710 == * Synonym(s): ** Esi_0027_0062 ** Esi0027_0062 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] ==
+
== Gene Ec-03_000710 ==
* smiles:
+
** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
+
* inchi key:
+
** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
+
* common name:
+
** dihydrozeatin-O-glucoside
+
* molecular weight:
+
** 383.403   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0027_0062
 +
** Esi0027_0062
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
* [[RXN-4726]]
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0027_0062|Esi0027_0062}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286]
+
{{#set: reaction associated=RXN-8443}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448]
+
* HMDB : HMDB12214
+
{{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}}
+
{{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}}
+
{{#set: common name=dihydrozeatin-O-glucoside}}
+
{{#set: molecular weight=383.403    }}
+
{{#set: produced by=RXN-4726}}
+

Revision as of 13:37, 21 March 2018

Gene Ec-03_000710

  • Synonym(s):
    • Esi_0027_0062
    • Esi0027_0062

Reactions associated

Pathways associated

External links