Difference between revisions of "HEXOKINASE-RXN"

Revision as of 13:38, 21 March 2018

"CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.

"4-hydroxy-2-nonenal-[Cys-Gly] conjugate" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Amino-Acids D-Amino-Acids] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
+* smiles:
+** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
+* inchi key:
+** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
 * common name:
-** a D-amino acid
+** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
+* molecular weight:
+** 334.43
 * Synonym(s):
-** D-&alpha;-amino acid
 == Reaction(s) known to consume the compound ==
+* [[RXN-13677]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-15041]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a D-amino acid}}
+* PUBCHEM:
-{{#set: common name=D-&alpha;-amino acid}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
-{{#set: produced by=RXN-15041}}
+{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
+{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
+{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
+{{#set: molecular weight=334.43    }}
+{{#set: consumed by=RXN-13677}}