Difference between revisions of "PWY-3861"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12539 RXN-12539] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12539 RXN-12539] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
 +
* inchi key:
 +
** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
 +
* common name:
 +
** dihydrozeatin-O-glucoside
 +
* molecular weight:
 +
** 383.403   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-479]][c] '''+''' 1 [[CPD-12377]][c] '''=>''' 1 [[ETHYLENE-CMPD]][c] '''+''' 2 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-7671]][c]
+
* [[RXN-4726]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 2-oxo-4-methylthiobutanoate[c] '''+''' 1 hydroxyl radical[c] '''=>''' 1 ethene[c] '''+''' 2 CO2[c] '''+''' 1 methanethiol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6854]], ethylene biosynthesis III (microbes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-6854}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB12214
 +
{{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}}
 +
{{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}}
 +
{{#set: common name=dihydrozeatin-O-glucoside}}
 +
{{#set: molecular weight=383.403    }}
 +
{{#set: produced by=RXN-4726}}

Revision as of 13:38, 21 March 2018

Metabolite CPD-4617

  • smiles:
    • CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
  • inchi key:
    • InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
  • common name:
    • dihydrozeatin-O-glucoside
  • molecular weight:
    • 383.403
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-3861&oldid=20336"