Difference between revisions of "PWY-4361"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-14_001090 == * left end position: ** 1065040 * transcription direction: ** POSITIVE * right end position: ** 1067893 * centisome position: ** 16.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_001090 == |
− | * | + | * left end position: |
− | ** | + | ** 1065040 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1067893 |
− | * | + | * centisome position: |
− | ** | + | ** 16.234306 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0256_0028 |
− | ** | + | ** Esi0256_0028 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.4.1.198-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=1065040}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1067893}} | |
− | + | {{#set: centisome position=16.234306 }} | |
− | + | {{#set: common name=Esi_0256_0028|Esi0256_0028}} | |
− | + | {{#set: reaction associated=2.4.1.198-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:38, 21 March 2018
Gene Ec-14_001090
- left end position:
- 1065040
- transcription direction:
- POSITIVE
- right end position:
- 1067893
- centisome position:
- 16.234306
- Synonym(s):
- Esi_0256_0028
- Esi0256_0028
Reactions associated
- Reaction: 2.4.1.198-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome