Difference between revisions of "Ec-07 007340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Gene == Gene Ec-26_001350 == * left end position: ** 1649980 * transcription direction: ** POSITIVE * right end position: ** 1654870 * centisome position: ** 25.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] ==
+
== Gene Ec-26_001350 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1649980
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA
+
** 1654870
−
* molecular weight:
+
* centisome position:
−
** 1049.959    
+
** 25.062931    
 
* Synonym(s):
 
* Synonym(s):
−
** icosatetraenoyl-CoA
+
** Esi_0161_0021
−
** eicosatetraenoyl-CoA
+
** Esi0161_0021
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16042]]
+
* Reaction: [[RXN-12502]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12503]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12504]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1649980}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581164 71581164]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1654870}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74265 74265]
+
{{#set: centisome position=25.062931   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0161_0021|Esi0161_0021}}
−
{{#set: inchi key=InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J}}
+
{{#set: reaction associated=RXN-12502|RXN-12503|RXN-12504}}
−
{{#set: common name=(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA}}
+
−
{{#set: molecular weight=1049.959   }}
+
−
{{#set: common name=icosatetraenoyl-CoA|eicosatetraenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16042}}
+

Revision as of 13:38, 21 March 2018

Gene Ec-26_001350

  • left end position:
    • 1649980
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1654870
  • centisome position:
    • 25.062931
  • Synonym(s):
    • Esi_0161_0021
    • Esi0161_0021

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_007340&oldid=20412"