Difference between revisions of "Ec-12 000650"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1-PHOSPHATASE-RXN MANNITOL-1-PHOSPHATASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1-PHOSPHATASE-RXN MANNITOL-1-PHOSPHATASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.1.3.22 EC-3.1.3.22] | |
− | * | + | |
− | ** | + | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[MANNITOL-1P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MANNITOL]][c] |
− | == | + | * With common name(s): |
+ | ** 1 D-mannitol 1-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 D-mannitol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-3881]], mannitol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3881 PWY-3881] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6531]], mannitol cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19537 19537] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02167 R02167] | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: ec number=EC-3.1.3.22}} | |
− | * LIGAND- | + | {{#set: in pathway=PWY-3881|PWY-6531}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=gap-filling}} |
− | {{#set: | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} |
− | {{#set: | + | {{#set: reconstruction tool=meneco}} |
− | {{#set: | + | {{#set: reconstruction comment=added for gapfilling}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:38, 21 March 2018
Contents
Reaction MANNITOL-1-PHOSPHATASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MANNITOL-1P[c] + 1 WATER[c] => 1 Pi[c] + 1 MANNITOL[c]
- With common name(s):
- 1 D-mannitol 1-phosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 D-mannitol[c]
Genes associated with this reaction
Pathways
- PWY-3881, mannitol biosynthesis: PWY-3881
- 2 reactions found over 3 reactions in the full pathway
- PWY-6531, mannitol cycle: PWY-6531
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
External links