Difference between revisions of "CIS-ACONITATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Amino-Acids L-Amino-Acids] == * common name: ** an L-amino acid * Synonym(s): ** an L-Amino a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Amino-Acids L-Amino-Acids] ==
* smiles:
+
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
+
* inchi key:
+
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
+
 
* common name:
 
* common name:
** N-acetyl-α-D-glucosamine 1-phosphate
+
** an L-amino acid
* molecular weight:
+
** 299.174   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an L-Amino acid
 +
** an L-2-amino-acid
 +
** L-α-amino acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAG1P-URIDYLTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.11.2-RXN]]
 +
* [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]]
 +
* [[CARBOXYPEPTIDASE-A-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 
* [[RXN-16426]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an L-amino acid}}
** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256]
+
{{#set: common name=an L-Amino acid|an L-2-amino-acid|L-α-amino acid}}
* CHEBI:
+
{{#set: produced by=3.4.11.2-RXN|GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN|CARBOXYPEPTIDASE-A-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776]
+
* BIGG : 43457
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937]
+
* HMDB : HMDB01367
+
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}}
+
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}}
+
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}}
+
{{#set: molecular weight=299.174    }}
+
{{#set: consumed by=NAG1P-URIDYLTRANS-RXN}}
+
{{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN|RXN-16426}}
+

Revision as of 13:39, 21 March 2018

Metabolite L-Amino-Acids

  • common name:
    • an L-amino acid
  • Synonym(s):
    • an L-Amino acid
    • an L-2-amino-acid
    • L-α-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links