Difference between revisions of "PWY-6908"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-08_002250 == * left end position: ** 2131363 * transcription direction: ** NEGATIVE * right end position: ** 2137480 * centisome position: ** 31.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_002250 == |
− | * | + | * left end position: |
− | ** | + | ** 2131363 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2137480 |
− | * | + | * centisome position: |
− | ** | + | ** 31.825325 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0007_0143 | ||
+ | ** Esi0007_0143 | ||
+ | ** CDKC1 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=2131363}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2137480}} | |
− | + | {{#set: centisome position=31.825325 }} | |
− | + | {{#set: common name=Esi_0007_0143|Esi0007_0143|CDKC1}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:39, 21 March 2018
Gene Ec-08_002250
- left end position:
- 2131363
- transcription direction:
- NEGATIVE
- right end position:
- 2137480
- centisome position:
- 31.825325
- Synonym(s):
- Esi_0007_0143
- Esi0007_0143
- CDKC1
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome