Difference between revisions of "PWY-7746"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...") |
(Created page with "Category:Gene == Gene Ec-01_000690 == * left end position: ** 514187 * transcription direction: ** POSITIVE * right end position: ** 516306 * centisome position: ** 4.9829...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_000690 == |
− | * | + | * left end position: |
− | ** | + | ** 514187 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 516306 |
− | * | + | * centisome position: |
− | ** | + | ** 4.982995 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0228_0017 |
+ | ** Esi0228_0017 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=514187}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=516306}} | |
− | + | {{#set: centisome position=4.982995 }} | |
− | + | {{#set: common name=Esi_0228_0017|Esi0228_0017}} | |
− | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:39, 21 March 2018
Gene Ec-01_000690
- left end position:
- 514187
- transcription direction:
- POSITIVE
- right end position:
- 516306
- centisome position:
- 4.982995
- Synonym(s):
- Esi_0228_0017
- Esi0228_0017
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome