Difference between revisions of "Holo-VibB"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-461 RXN1F-461] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-461 RXN1F-461] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCSCC([N+])C(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.91 EC-2.4.1.91]
+
** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
 +
* common name:
 +
** S-prenyl-L-cysteine
 +
* molecular weight:
 +
** 189.272   
 
* Synonym(s):
 
* Synonym(s):
 +
** prenyl-L-cysteine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.8.3.5-RXN]]
−
** 1 [[CPD1F-90]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-453]][c] '''+''' 1 [[UDP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 kaempferol[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 H+[c] '''+''' 1 kaempferol-3-glucoside[c] '''+''' 1 UDP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_000870]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-04_004610]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-5320]], kaempferol glycoside biosynthesis (Arabidopsis): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5320 PWY-5320]
+
−
** '''1''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-7143]], kaempferol gentiobioside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7143 PWY-7143]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-7168]]: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7168 PWY-7168]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-5348]], kaempferol triglucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5348 PWY-5348]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.4.1.91}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435]
−
{{#set: gene associated=Ec-14_000870|Ec-04_004610}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5320|PWY-7143|PWY-7168|PWY-5348}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-aragem}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751]
−
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB12286
 +
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}}
 +
{{#set: common name=S-prenyl-L-cysteine}}
 +
{{#set: molecular weight=189.272    }}
 +
{{#set: common name=prenyl-L-cysteine}}
 +
{{#set: consumed by=1.8.3.5-RXN}}

Revision as of 13:39, 21 March 2018

Metabolite S-PRENYL-L-CYSTEINE

  • smiles:
    • CC(C)=CCSCC([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
  • common name:
    • S-prenyl-L-cysteine
  • molecular weight:
    • 189.272
  • Synonym(s):
    • prenyl-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Holo-VibB&oldid=20507"