Difference between revisions of "CPD-4211"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12440 RXN-12440] == * direction: ** LEFT-TO-RIGHT * common name: ** Haem peroxidase, plant/fung...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12440 RXN-12440] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(O)C(O)C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
+
 
* common name:
 
* common name:
−
** β-D-galactose
+
** Haem peroxidase, plant/fungal/bacterial
−
* molecular weight:
+
** ascorbate peroxidase
−
** 180.157   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.11.1.11 EC-1.11.1.11]
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-galactopyranose
 
−
** cerebrose
 
−
** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[BETAGALACTOSID-RXN]]
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[ASCORBATE]][c] '''=>''' 1 [[ASCORBATE]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 2 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[ALDOSE1EPIM-RXN]]
+
** 1 hydrogen peroxide[c] '''+''' 1 H+[c] '''+''' 2 L-ascorbate[c] '''=>''' 1 L-ascorbate[c] '''+''' 1 L-dehydro-ascorbate[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_001210]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-19_000230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-02_001740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6960]], L-ascorbate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6961]], L-ascorbate degradation II (bacterial, aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6961 PWY-6961]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 7296-64-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Haem peroxidase, plant/fungal/bacterial}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353]
+
{{#set: common name=ascorbate peroxidase}}
−
* HMDB : HMDB03449
+
{{#set: ec number=EC-1.11.1.11}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-02_001210|Ec-19_000230|Ec-02_001740}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962]
+
{{#set: in pathway=PWY-6959|PWY-6960|PWY-6961}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.388476.html 388476]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034]
+
−
* BIGG : 37923
+
−
{{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}}
+
−
{{#set: common name=β-D-galactose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: common name=β-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}}
+
−
{{#set: produced by=BETAGALACTOSID-RXN}}
+
−
{{#set: reversible reaction associated=ALDOSE1EPIM-RXN}}
+

Revision as of 13:40, 21 March 2018

Reaction RXN-12440

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Haem peroxidase, plant/fungal/bacterial
    • ascorbate peroxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6959, L-ascorbate degradation V: PWY-6959
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-6960, L-ascorbate degradation III: PWY-6960
    • 3 reactions found over 6 reactions in the full pathway
  • PWY-6961, L-ascorbate degradation II (bacterial, aerobic): PWY-6961
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-4211&oldid=20563"