Difference between revisions of "SULFATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10939 RXN-10939] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10939 RXN-10939] ==
* smiles:
+
* direction:
** C=C1(C(CC([N+])C([O-])=O)C1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/3.1.3.57 EC-3.1.3.57]
* common name:
+
** hypoglycin A
+
* molecular weight:
+
** 141.169   
+
 
* Synonym(s):
 
* Synonym(s):
** hypoglycine
 
** hypoglycine A
 
** hypoglycin
 
** L-β-(methylenecyclopropyl)-alanine
 
** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9157]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[D-MYO-INOSITOL-34-BISPHOSPHATE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 D-myo-inositol (1,3,4)-trisphosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 D-myo-inositol (3,4)-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_006130]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03427 R03427]
* Wikipedia : Hypoglycin
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIGAND-CPD:
+
{{#set: ec number=EC-3.1.3.57}}
** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287]
+
{{#set: gene associated=Ec-14_006130}}
* HMDB : HMDB29427
+
{{#set: in pathway=}}
{{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}}
+
{{#set: reconstruction source=orthology-aragem}}
{{#set: common name=hypoglycin A}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=141.169    }}
+
{{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}}
+
{{#set: consumed by=RXN-9157}}
+

Revision as of 13:40, 21 March 2018

Reaction RXN-10939

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links