Difference between revisions of "DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-ACETO-ACETYL-COA 2-METHYL-ACETO-ACETYL-COA] == * smiles: ** CC(C(SCCNC(=O)CCNC(=O)C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] == * direction: ** LEFT-TO-RIGHT * common name: ** Sulphate adenylyltransferas...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-ACETO-ACETYL-COA 2-METHYL-ACETO-ACETYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] ==
−
* smiles:
+
* direction:
−
** CC(C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C(=O)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NHNODHRSCRALBF-NQNBQJKNSA-J
+
 
* common name:
 
* common name:
−
** 2-methylacetoacetyl-CoA
+
** Sulphate adenylyltransferase catalytic domain
−
* molecular weight:
+
* ec number:
−
** 861.604   
+
** [http://enzyme.expasy.org/EC/2.7.7.4 EC-2.7.7.4]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methyl-3-acetoacetyl-CoA
 
−
** 2-methylacetoacetyl coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ATP]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[SELENATE]][c] '''=>''' 1 [[CPD-13713]][c] '''+''' 1 [[PPI]][c]
−
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* With common name(s):
−
* [[1.1.1.178-RXN]]
+
** 1 ATP[c] '''+''' 2 H+[c] '''+''' 1 selenate[c] '''=>''' 1 adenosine 5'-phosphoselenate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_000870]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-12_000240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6932]], selenate reduction: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6932 PWY-6932]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6712-01-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Sulphate adenylyltransferase catalytic domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266568 45266568]
+
{{#set: ec number=EC-2.7.7.4}}
−
* HMDB : HMDB01157
+
{{#set: gene associated=Ec-02_000870|Ec-12_000240}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6932}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03344 C03344]
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57335 57335]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* METABOLIGHTS : MTBLC57335
+
−
{{#set: smiles=CC(C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C(=O)C}}
+
−
{{#set: inchi key=InChIKey=NHNODHRSCRALBF-NQNBQJKNSA-J}}
+
−
{{#set: common name=2-methylacetoacetyl-CoA}}
+
−
{{#set: molecular weight=861.604    }}
+
−
{{#set: common name=2-methyl-3-acetoacetyl-CoA|2-methylacetoacetyl coenzyme A}}
+
−
{{#set: reversible reaction associated=METHYLACETOACETYLCOATHIOL-RXN|1.1.1.178-RXN}}
+

Revision as of 13:40, 21 March 2018

Reaction RXN-12720

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Sulphate adenylyltransferase catalytic domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 2 H+[c] + 1 selenate[c] => 1 adenosine 5'-phosphoselenate[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6932, selenate reduction: PWY-6932
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR&oldid=20605"