Difference between revisions of "Menaquinones"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...")
(Created page with "Category:Gene == Gene Ec-12_002140 == * left end position: ** 1964677 * transcription direction: ** NEGATIVE * right end position: ** 1970929 * centisome position: ** 23.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
+
== Gene Ec-12_002140 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 1964677
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (5α)-campestan-3-one
+
** 1970929
−
* molecular weight:
+
* centisome position:
−
** 400.687    
+
** 23.568436    
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestanone
+
** Esi_0144_0027
−
** (24R)-24-methyl-5α-cholestan-3-one
+
** Esi0144_0027
−
** 3-dehydro-campestanol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[INORGPYROPHOSPHAT-RXN]]
−
* [[RXN-711]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1964677}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201374 25201374]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=1970929}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786]
+
{{#set: centisome position=23.568436   }}
−
* HMDB : HMDB12116
+
{{#set: common name=Esi_0144_0027|Esi0144_0027}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction associated=INORGPYROPHOSPHAT-RXN}}
−
{{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}}
+
−
{{#set: common name=(5α)-campestan-3-one}}
+
−
{{#set: molecular weight=400.687   }}
+
−
{{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}}
+
−
{{#set: produced by=RXN-711}}
+

Revision as of 13:40, 21 March 2018

Gene Ec-12_002140

  • left end position:
    • 1964677
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1970929
  • centisome position:
    • 23.568436
  • Synonym(s):
    • Esi_0144_0027
    • Esi0144_0027

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Menaquinones&oldid=20617"