Difference between revisions of "SEROTONIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCERATE GLYCERATE] == * smiles: ** C(=O)([O-])C(O)CO * inchi key: ** InChIKey=RBNPOMFGQQGHHO-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == * smiles: ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] * inchi key: ** InChIKey=IMUGYKF...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M |
* common name: | * common name: | ||
| − | ** D- | + | ** 5-dehydro-4-deoxy-D-glucuronate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 175.118 |
* Synonym(s): | * Synonym(s): | ||
| − | ** ( | + | ** 4-deoxy-L-threo-5-hexosulose uronate |
| − | ** | + | ** 4,5-dihydroxy-2,6-dioxo-hexanoate |
| − | ** | + | ** (4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate |
| + | ** 5-keto-4-deoxyuronate | ||
| + | ** DKI | ||
| + | ** 4-deoxy-5-ketouronic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-16475]] |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548606 9548606] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.7827529.html 7827529] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17117 17117] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04053 C04053] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=[CH](=O)C(O)C(O)CC(=O)C(=O)[O-]}} |
| − | {{#set: common name=D- | + | {{#set: inchi key=InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=5-dehydro-4-deoxy-D-glucuronate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=175.118 }} |
| − | + | {{#set: common name=4-deoxy-L-threo-5-hexosulose uronate|4,5-dihydroxy-2,6-dioxo-hexanoate|(4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate|5-keto-4-deoxyuronate|DKI|4-deoxy-5-ketouronic acid}} | |
| − | + | {{#set: reversible reaction associated=RXN-16475}} | |
| − | {{#set: reversible reaction associated=RXN- | + | |
Revision as of 13:40, 21 March 2018
Contents
Metabolite CPD-37
- smiles:
- [CH](=O)C(O)C(O)CC(=O)C(=O)[O-]
- inchi key:
- InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M
- common name:
- 5-dehydro-4-deoxy-D-glucuronate
- molecular weight:
- 175.118
- Synonym(s):
- 4-deoxy-L-threo-5-hexosulose uronate
- 4,5-dihydroxy-2,6-dioxo-hexanoate
- (4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate
- 5-keto-4-deoxyuronate
- DKI
- 4-deoxy-5-ketouronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)CC(=O)C(=O)[O-" cannot be used as a page name in this wiki.
