Difference between revisions of "CPD-37"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == * smiles: ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FBZONXHGGPHHIY-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** xanthurenate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 203.154 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10722]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02470 C02470] |
| − | * HMDB : | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71201 71201] |
| − | {{#set: inchi key=InChIKey= | + | * METABOLIGHTS : MTBLC71201 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203183 25203183] |
| − | + | * HMDB : HMDB00881 | |
| − | {{#set: produced by=RXN- | + | {{#set: smiles=C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-]))}} |
| + | {{#set: inchi key=InChIKey=FBZONXHGGPHHIY-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=xanthurenate}} | ||
| + | {{#set: molecular weight=203.154 }} | ||
| + | {{#set: produced by=RXN-10722}} | ||
Revision as of 13:40, 21 March 2018
Contents
Metabolite XANTHURENATE
- smiles:
- C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-]))
- inchi key:
- InChIKey=FBZONXHGGPHHIY-UHFFFAOYSA-L
- common name:
- xanthurenate
- molecular weight:
- 203.154
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-]))" cannot be used as a page name in this wiki.
