Difference between revisions of "Ec-19 004160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9632 RXN-9632] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-stearoyl-[acyl-carrier...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9632 RXN-9632] ==
−
* smiles:
+
* direction:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
+
 
* common name:
 
* common name:
−
** episterol
+
** 3-oxo-stearoyl-[acyl-carrier protein] synthase
−
* molecular weight:
+
** Beta-ketoacyl synthase, N-terminal
−
** 398.671   
+
** beta-ketoacyl synthase, partial
 +
** Thiolase-like, subgroup
 +
** 3-oxoacyl-[acyl-carrier-protein] synthase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN3O-218]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Palmitoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-oxo-stearoyl-ACPs]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a palmitoyl-[acp][c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 a 3-oxo-stearoyl-[acp][c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_003480]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-27_002090]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-12_000640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-12_000650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
+
{{#set: common name=3-oxo-stearoyl-[acyl-carrier protein] synthase}}
−
* CHEBI:
+
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
+
{{#set: common name=beta-ketoacyl synthase, partial}}
−
* LIGAND-CPD:
+
{{#set: common name=Thiolase-like, subgroup}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
+
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
−
* HMDB : HMDB06847
+
{{#set: ec number=EC-2.3.1.41}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
+
{{#set: gene associated=Ec-27_003480|Ec-27_002090|Ec-12_000640|Ec-12_000650}}
−
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
+
{{#set: in pathway=PWY-5989}}
−
{{#set: common name=episterol}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=398.671    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: consumed by=RXN3O-218}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 14:40, 21 March 2018

Reaction RXN-9632

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-stearoyl-[acyl-carrier protein] synthase
    • Beta-ketoacyl synthase, N-terminal
    • beta-ketoacyl synthase, partial
    • Thiolase-like, subgroup
    • 3-oxoacyl-[acyl-carrier-protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5989, stearate biosynthesis II (bacteria and plants): PWY-5989
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

"3-oxo-stearoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.


"3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_004160&oldid=20683"