Difference between revisions of "Ec-12 005240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
(Created page with "Category:Gene == Gene Ec-04_005890 == * left end position: ** 5826105 * transcription direction: ** POSITIVE * right end position: ** 5842432 * centisome position: ** 89.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
+
== Gene Ec-04_005890 ==
−
* smiles:
+
* left end position:
−
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
+
** 5826105
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ferroheme b
+
** 5842432
−
* molecular weight:
+
* centisome position:
−
** 614.482    
+
** 89.46926    
 
* Synonym(s):
 
* Synonym(s):
−
** protoheme IX
+
** Esi_0140_0042
−
** ferroprotoporphyrin IX
+
** Esi0140_0042
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[PROTOHEMEFERROCHELAT-RXN]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CHEBI:
+
{{#set: left end position=5826105}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
+
{{#set: right end position=5842432}}
−
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
+
{{#set: centisome position=89.46926   }}
−
{{#set: common name=ferroheme b}}
+
{{#set: common name=Esi_0140_0042|Esi0140_0042}}
−
{{#set: molecular weight=614.482   }}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
−
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
+
−
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+

Revision as of 13:40, 21 March 2018

Gene Ec-04_005890

  • left end position:
    • 5826105
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5842432
  • centisome position:
    • 89.46926
  • Synonym(s):
    • Esi_0140_0042
    • Esi0140_0042

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_005240&oldid=20696"