Difference between revisions of "RXN-11152"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * smiles: ** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Ec-07_004980 == * left end position: ** 4878043 * transcription direction: ** NEGATIVE * right end position: ** 4882747 * centisome position: ** 63.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] ==
+
== Gene Ec-07_004980 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 4878043
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2E,5Z)-tetradecenoyl-CoA
+
** 4882747
−
* molecular weight:
+
* centisome position:
−
** 969.83    
+
** 63.167202    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-trans,5-cis-tetradecenoyl-CoA
+
** Esi_0125_0019
−
** 14:2-Δ2,Δ5-CoA
+
** Esi0125_0019
−
** 2-trans,5-cis-tetradecadienoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-5393]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14576]]
+
*** Assignment: automated-name-match
−
* [[RXN-17783]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4878043}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244134 25244134]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4882747}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87701 87701]
+
{{#set: centisome position=63.167202   }}
−
{{#set: smiles=CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0125_0019|Esi0125_0019}}
−
{{#set: inchi key=InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: common name=(2E,5Z)-tetradecenoyl-CoA}}
+
−
{{#set: molecular weight=969.83   }}
+
−
{{#set: common name=2-trans,5-cis-tetradecenoyl-CoA|14:2-Δ2,Δ5-CoA|2-trans,5-cis-tetradecadienoyl-CoA}}
+
−
{{#set: consumed by=RXN0-5393}}
+
−
{{#set: produced by=RXN-14576|RXN-17783}}
+

Revision as of 13:41, 21 March 2018

Gene Ec-07_004980

  • left end position:
    • 4878043
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4882747
  • centisome position:
    • 63.167202
  • Synonym(s):
    • Esi_0125_0019
    • Esi0125_0019

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11152&oldid=20746"