Difference between revisions of "RXN-14384"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Gene == Gene Ec-21_006220 == * left end position: ** 7084129 * transcription direction: ** NEGATIVE * right end position: ** 7089373 * centisome position: ** 95.9...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] ==
+
== Gene Ec-21_006220 ==
* smiles:
+
* left end position:
** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 7084129
* inchi key:
+
* transcription direction:
** InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
** 7089373
* molecular weight:
+
* centisome position:
** 1102.034    
+
** 95.98936    
 
* Synonym(s):
 
* Synonym(s):
** tetracosahexaenoyl-CoA
+
** Esi_0014_0172
** all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA
+
** Esi0014_0172
** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
+
** GGT
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16134]]
+
* Reaction: [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-16132]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-6601]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9157]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-336]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-4041]]
 +
* [[PWY-5826]]
 +
* [[PWY66-375]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=7084129}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581194 71581194]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=7089373}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74086 74086]
+
{{#set: centisome position=95.98936   }}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0014_0172|Esi0014_0172|GGT}}
{{#set: inchi key=InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J}}
+
{{#set: reaction associated=GAMMA-GLUTAMYLTRANSFERASE-RXN|RXN-6601|RXN-9157|RXN66-336}}
{{#set: common name=(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
{{#set: pathway associated=PWY-4041|PWY-5826|PWY66-375}}
{{#set: molecular weight=1102.034   }}
+
{{#set: common name=tetracosahexaenoyl-CoA|all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA|(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}}
+
{{#set: consumed by=RXN-16134}}
+
{{#set: produced by=RXN-16132}}
+

Revision as of 13:41, 21 March 2018

Gene Ec-21_006220

  • left end position:
    • 7084129
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7089373
  • centisome position:
    • 95.98936
  • Synonym(s):
    • Esi_0014_0172
    • Esi0014_0172
    • GGT

Reactions associated

Pathways associated

External links