Difference between revisions of "5-Methylcytosine-DNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_000540 == * left end position: ** 535523 * transcription direction: ** NEGATIVE * right end position: ** 539256 * centisome position: ** 10.385...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * inchi...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-20_000540 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] ==
−
* left end position:
+
* smiles:
−
** 535523
+
** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
−
* right end position:
+
* common name:
−
** 539256
+
** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
−
* centisome position:
+
* molecular weight:
−
** 10.385556    
+
** 450.508    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0058_0052
 
−
** Esi0058_0052
 
−
** PK
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-16118]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN-16117]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=535523}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820233 91820233]
−
{{#set: right end position=539256}}
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}}
−
{{#set: centisome position=10.385556   }}
+
{{#set: inchi key=InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L}}
−
{{#set: common name=Esi_0058_0052|Esi0058_0052|PK}}
+
{{#set: common name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
−
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
{{#set: molecular weight=450.508   }}
 +
{{#set: consumed by=RXN-16118}}
 +
{{#set: produced by=RXN-16117}}

Revision as of 13:41, 21 March 2018

Metabolite CPD-17372

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
  • inchi key:
    • InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
  • common name:
    • 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
  • molecular weight:
    • 450.508
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoleyl]-2-lyso-phosphatidate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-Methylcytosine-DNA&oldid=20781"