Difference between revisions of "RXN-17352"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15556 RXN-15556] == * direction: ** LEFT-TO-RIGHT * common name: ** Ubiquitin-conjugating enzym...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O |
+ | * inchi key: | ||
+ | ** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 1-18:1-2-18:1-phosphatidylethanolamine |
− | + | * molecular weight: | |
− | + | ** 744.043 | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** phosphatidylethanolamine (1-18:1-2-18:1) | ||
+ | ** 18:1-18:1-PE | ||
+ | ** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-15067]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-15036]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986] |
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}} |
− | {{#set: | + | {{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}} |
− | {{#set: | + | {{#set: molecular weight=744.043 }} |
− | + | {{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}} | |
− | + | {{#set: consumed by=RXN-15067}} | |
+ | {{#set: reversible reaction associated=RXN-15036}} |
Revision as of 13:41, 21 March 2018
Contents
Metabolite CPD-8291
- smiles:
- CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
- inchi key:
- InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
- common name:
- 1-18:1-2-18:1-phosphatidylethanolamine
- molecular weight:
- 744.043
- Synonym(s):
- phosphatidylethanolamine (1-18:1-2-18:1)
- 18:1-18:1-PE
- 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O" cannot be used as a page name in this wiki.