Difference between revisions of "RXN-10715"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
(Created page with "Category:Gene == Gene Ec-12_008200 == * left end position: ** 7338243 * transcription direction: ** POSITIVE * right end position: ** 7353862 * centisome position: ** 88.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
+
== Gene Ec-12_008200 ==
−
* smiles:
+
* left end position:
−
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
+
** 7338243
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** nicotine-1'-N-oxide
+
** 7353862
−
* molecular weight:
+
* centisome position:
−
** 178.233    
+
** 88.0302    
 
* Synonym(s):
 
* Synonym(s):
−
** nicotine N'-oxide
+
** Esi_0130_0056
 +
** Esi0130_0056
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[FUCOKINASE-RXN]]
−
* [[RXN66-81]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7338243}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=7353862}}
−
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
+
{{#set: centisome position=88.0302   }}
−
* HMDB : HMDB01497
+
{{#set: common name=Esi_0130_0056|Esi0130_0056}}
−
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
+
{{#set: reaction associated=FUCOKINASE-RXN}}
−
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
+
{{#set: pathway associated=PWY-6}}
−
{{#set: common name=nicotine-1'-N-oxide}}
+
−
{{#set: molecular weight=178.233   }}
+
−
{{#set: common name=nicotine N'-oxide}}
+
−
{{#set: produced by=RXN66-81}}
+

Revision as of 13:41, 21 March 2018

Gene Ec-12_008200

  • left end position:
    • 7338243
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7353862
  • centisome position:
    • 88.0302
  • Synonym(s):
    • Esi_0130_0056
    • Esi0130_0056

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10715&oldid=20791"